Source code for qse.qbits

"""
This module defines the central object in the QSE package: the Qbits object.
"""

import copy
import numbers
from math import cos, sin

import numpy as np
from ase.cell import Cell
from ase.geometry import (
    find_mic,
    get_dihedrals,
)
from ase.utils import deprecated

from qse.qbit import Qbit
from qse.visualise import draw as _draw


[docs] class Qbits: """ The Qbits object can represent an isolated molecule, or a periodically repeated structure. It has a unit cell and there may be periodic boundary conditions along any of the three unit cell axes. Information about the qbits (qubit state and position) is stored in ndarrays. Parameters ---------- labels: list of str A list of strings corresponding to a label for each qubit. states: list of 2-length arrays. State of each qubit. positions: list of xyz-positions Qubit positions. Anything that can be converted to an ndarray of shape (n, 3) will do: [(x1,y1,z1), (x2,y2,z2), ...]. scaled_positions: list of scaled-positions Like positions, but given in units of the unit cell. Can not be set at the same time as positions. cell: 3x3 matrix or length 3 or 6 vector Unit cell vectors. Can also be given as just three numbers for orthorhombic cells, or 6 numbers, where first three are lengths of unit cell vectors, and the other three are angles between them (in degrees), in following order: [len(a), len(b), len(c), angle(b,c), angle(a,c), angle(a,b)]. First vector will lie in x-direction, second in xy-plane, and the third one in z-positive subspace. Default value: [0, 0, 0]. celldisp: Vector Unit cell displacement vector. To visualize a displaced cell around the center of mass of a Systems of qbits. Default value = (0,0,0) pbc: one or three bool Periodic boundary conditions flags. Examples: True, False, 0, 1, (1, 1, 0), (True, False, False). Default value: False. constraint: constraint object(s) Used for applying one or more constraints during structure optimization. calculator: calculator object Used to attach a calculator for doing computation. info: dict of key-value pairs Dictionary of key-value pairs with additional information about the system. The following keys may be used by ase: - spacegroup: Spacegroup instance - unit_cell: 'conventional' | 'primitive' | int | 3 ints - adsorbate_info: Information about special adsorption sites Items in the info attribute survives copy and slicing and can be stored in and retrieved from trajectory files given that the key is a string, the value is JSON-compatible and, if the value is a user-defined object, its base class is importable. One should not make any assumptions about the existence of keys. Examples -------- Empty Qbits object: >>> qs = qse.Qbits() These are equivalent: >>> a = qse.Qbits( ... labels=['qb1', 'qb2'], ... positions=np.array([(0, 0, 0), (0, 0, 2)]) ... ) >>> a = qse.Qbits.from_qbit_list( ... [Qbit('qb1', position=(0, 0, 0)), Qbit('qb2', position=(0, 0, 2))] ... ) >>> xd = np.array( ... [[0, 0, 0], ... [0.5, 0.5, 0.5]]) >>> qdim = qse.Qbits(positions=xd) >>> qdim.cell = [1,1,1] >>> qdim.pbc = True >>> qlat = qdim.repeat([3,3,3]) The qdim will have shape = (2,1,1) and qlat will have shape = (6, 3, 3) Notes ----- In order to do computation, a calculator object has to attached to the qbits object. """ def __init__( self, labels=None, states=None, positions=None, scaled_positions=None, cell=None, pbc=None, celldisp=None, constraint=None, calculator=None, info=None, ): if (positions is not None) and (scaled_positions is not None): raise Exception( "Both 'positions' and 'scaled_positions'" " cannot be passed at the same time." ) if (scaled_positions is not None) and (cell is None): raise Exception("'scaled_positions' requires 'cell' to not be None.") # get number of qubits if labels is None: if positions is not None: nqbits = len(positions) elif scaled_positions is not None: nqbits = len(scaled_positions) else: nqbits = 0 else: if not isinstance(labels, list): raise Exception("'labels' must be a list.") nqbits = len(labels) if (positions is not None) and (len(positions) != nqbits): raise Exception("Both 'positions' and 'labels' must have the same length.") if (scaled_positions is not None) and (len(scaled_positions) != nqbits): raise Exception( "Both 'scaled_positions' and 'labels' must have the same length." ) self.arrays = {} # labels if labels is None: labels = [str(i) for i in range(nqbits)] # We allow for labels up to length 12. self.new_array("labels", labels, "<U12") # cell self._cellobj = Cell.new() if cell is None: cell = np.zeros((3, 3)) self.set_cell(cell) # positions if positions is None: if scaled_positions is None: positions = np.zeros((len(self.arrays["labels"]), 3)) else: assert self.cell.rank == 3 positions = np.dot(scaled_positions, self.cell) self.new_array("positions", positions, float, (3,)) # states if states is None: states = np.zeros((positions.shape[0], 2), dtype=complex) states[:, 0] = 1 self.new_array("states", states, complex, (2,)) # shape self._shape = (self.nqbits, 1, 1) # pbc self._pbc = np.zeros(3, bool) if pbc is None: pbc = False self.set_pbc(pbc) # celldisp if celldisp is None: celldisp = np.zeros(shape=(3, 1)) self.set_celldisp(celldisp) # constraint self.set_constraint(constraint) # calculator self.calc = calculator # info self.info = {} if info is None else dict(info) @classmethod def from_qbit_list(self, qbit_list): # Get data from a list or tuple of Qbit objects: data = { f"{name}s": [qbit.get_raw(name) for qbit in qbit_list] for name in ["label", "state", "position"] } return Qbits(**data) @property def shape(self): """The shape of the qbits""" return self._shape @shape.setter def shape(self, new_shape): """Update the shape to new shape""" if self.nqbits != np.prod(new_shape): raise AssertionError(f"no. of qubits= {self.nqbits}, yet shape {new_shape}") self._shape = new_shape @property def calc(self): """Calculator object.""" return self._calc @calc.setter def calc(self, calc): self._calc = calc if hasattr(calc, "set_qbits"): calc.set_qbits(self)
[docs] def set_constraint(self, constraint=None): """Apply one or more constrains. The *constraint* argument must be one constraint object or a list of constraint objects.""" if constraint is None: self._constraints = [] else: if isinstance(constraint, list): self._constraints = constraint elif isinstance(constraint, tuple): self._constraints = list(constraint) else: self._constraints = [constraint]
def _get_constraints(self): return self._constraints def _del_constraints(self): self._constraints = [] constraints = property( _get_constraints, set_constraint, _del_constraints, "Constraints of the qbits." )
[docs] def set_cell(self, cell, scale_qbits=False, apply_constraint=True): """Set unit cell vectors. Parameters: cell: 3x3 matrix or length 3 or 6 vector Unit cell. A 3x3 matrix (the three unit cell vectors) or just three numbers for an orthorhombic cell. Another option is 6 numbers, which describes unit cell with lengths of unit cell vectors and with angles between them (in degrees), in following order: [len(a), len(b), len(c), angle(b,c), angle(a,c), angle(a,b)]. First vector will lie in x-direction, second in xy-plane, and the third one in z-positive subspace. scale_qbits: bool Fix qbit positions or move qbits with the unit cell? Default behavior is to *not* move the qbits (scale_qbits=False). apply_constraint: bool Whether to apply constraints to the given cell. Examples: Two equivalent ways to define an orthorhombic cell: >>> qbits = Qbits('He') >>> a, b, c = 7, 7.5, 8 >>> qbits.set_cell([a, b, c]) >>> qbits.set_cell([(a, 0, 0), (0, b, 0), (0, 0, c)]) FCC unit cell: >>> qbits.set_cell([(0, b, b), (b, 0, b), (b, b, 0)]) Hexagonal unit cell: >>> qbits.set_cell([a, a, c, 90, 90, 120]) Rhombohedral unit cell: >>> alpha = 77 >>> qbits.set_cell([a, a, a, alpha, alpha, alpha]) """ # Override pbcs if and only if given a Cell object: # print('here', cell) cell = Cell.new(cell) # XXX not working well during initialize due to missing _constraints if apply_constraint and hasattr(self, "_constraints"): for constraint in self.constraints: if hasattr(constraint, "adjust_cell"): constraint.adjust_cell(self, cell) if scale_qbits: M = np.linalg.solve(self.cell.complete(), cell.complete()) self.positions[:] = np.dot(self.positions, M) self.cell[:] = cell
[docs] def set_celldisp(self, celldisp): """Set the unit cell displacement vectors.""" celldisp = np.array(celldisp, float) self._celldisp = celldisp
[docs] def get_celldisp(self): """Get the unit cell displacement vectors.""" return self._celldisp.copy()
[docs] def get_cell(self, complete=False): """Get the three unit cell vectors as a `class`:ase.cell.Cell` object. The Cell object resembles a 3x3 ndarray, and cell[i, j] is the jth Cartesian coordinate of the ith cell vector.""" if complete: return self.cell.complete() return self.cell.copy()
[docs] @deprecated("Please use qbits.cell.cellpar() instead") def get_cell_lengths_and_angles(self): """Get unit cell parameters. Sequence of 6 numbers. First three are unit cell vector lengths and second three are angles between them:: [len(a), len(b), len(c), angle(b,c), angle(a,c), angle(a,b)] in degrees. """ return self.cell.cellpar()
[docs] @deprecated("Please use qbits.cell.reciprocal()") def get_reciprocal_cell(self): """Get the three reciprocal lattice vectors as a 3x3 ndarray. Note that the commonly used factor of 2 pi for Fourier transforms is not included here.""" return self.cell.reciprocal()
@property def nqbits(self): return len(self) @property def pbc(self): """Reference to pbc-flags for in-place manipulations.""" return self._pbc @pbc.setter def pbc(self, pbc): self._pbc[:] = pbc
[docs] def set_pbc(self, pbc): """Set periodic boundary condition flags.""" self.pbc = pbc
[docs] def get_pbc(self): """Get periodic boundary condition flags.""" return self.pbc.copy()
[docs] def new_array(self, name, a, dtype=None, shape=None): """Add new array. If *shape* is not *None*, the shape of *a* will be checked.""" if dtype is not None: a = np.array(a, dtype, order="C") if len(a) == 0 and shape is not None: a.shape = (-1,) + shape else: if not a.flags["C_CONTIGUOUS"]: a = np.ascontiguousarray(a) else: a = a.copy() if name in self.arrays: raise RuntimeError("Array {} already present".format(name)) for b in self.arrays.values(): if len(a) != len(b): raise ValueError( 'Array "%s" has wrong length: %d != %d.' % (name, len(a), len(b)) ) break if shape is not None and a.shape[1:] != shape: raise ValueError( 'Array "%s" has wrong shape %s != %s.' % (name, a.shape, (a.shape[0:1] + shape)) ) self.arrays[name] = a
[docs] def get_array(self, name, copy=True): """Get an array. Returns a copy unless the optional argument copy is false. """ if copy: return self.arrays[name].copy() else: return self.arrays[name]
[docs] def set_array(self, name, a, dtype=None, shape=None): """Update array. If *shape* is not *None*, the shape of *a* will be checked. If *a* is *None*, then the array is deleted.""" b = self.arrays.get(name) if b is None: if a is not None: self.new_array(name, a, dtype, shape) else: if a is None: del self.arrays[name] else: a = np.asarray(a) if a.shape != b.shape: raise ValueError( 'Array "%s" has wrong shape %s != %s.' % (name, a.shape, b.shape) ) b[:] = a
[docs] def has(self, name): """ Check for existence of array. name must be one of: 'momenta', 'masses', 'initial_magmoms', 'initial_charges'. """ # XXX extend has to calculator properties return name in self.arrays
[docs] def get_properties(self, properties): """This method is experimental; currently for internal use.""" # XXX Something about constraints. if self._calc is None: raise RuntimeError("Qbits object has no calculator.") return self._calc.calculate_properties(self, properties)
[docs] def copy(self): """Return a copy.""" qbits = self.__class__( cell=self.cell, pbc=self.pbc, info=self.info, celldisp=self._celldisp.copy() ) qbits.arrays = {} for name, a in self.arrays.items(): qbits.arrays[name] = a.copy() qbits.constraints = copy.deepcopy(self.constraints) # qbits.shape = self.shape # this was necessary, and took long time to realise! return qbits
[docs] def todict(self): """For basic JSON (non-database) support.""" # d = dict(self.arrays) d = {} d["labels"] = self.arrays["labels"] d["positions"] = self.arrays["positions"] d["states"] = self.arrays["states"] d["cell"] = self.cell # np.asarray(self.cell) d["pbc"] = self.pbc if self._celldisp.any(): d["celldisp"] = self._celldisp if self.constraints: d["constraints"] = self.constraints if self.info: d["info"] = self.info # Calculator... trouble. return d
[docs] @classmethod def fromdict(cls, dct): """Rebuild qbits object from dictionary representation (todict).""" dct = dct.copy() kw = {} for name in ["labels", "positions", "states", "cell", "pbc"]: kw[name] = dct.pop(name) constraints = dct.pop("constraints", None) if constraints: from ase.constraints import dict2constraint constraints = [dict2constraint(d) for d in constraints] # labels = dct.pop('labels', None) info = dct.pop("info", None) qbits = cls( constraint=constraints, celldisp=dct.pop("celldisp", None), info=info, **kw ) nqbits = len(qbits) # Some arrays are named differently from the qbits __init__ keywords. # Also, there may be custom arrays. Hence we set them directly: for name, arr in dct.items(): assert len(arr) == nqbits, name assert isinstance(arr, np.ndarray) qbits.arrays[name] = arr return qbits
def __len__(self): return len(self.arrays["positions"]) def __repr__(self): """We use pymatgen type of style to print Qbits class""" tokens = [] insep = " " N = len(self) if N < 33: for i in self: tokens.append("{0}".format(i) + ",\n") else: for i in self[:3]: tokens.append("{0}".format(i) + ",\n") tokens.append("...\n") for i in self[-3:]: tokens.append("{0}".format(i) + ",\n") if self.pbc.any() and not self.pbc.all(): txt = "pbc={0}".format(self.pbc.tolist()) else: txt = "pbc={0}".format(self.pbc[0]) tokens.append(txt + ",\n") cell = self.cell if cell: if cell.orthorhombic: cell = cell.lengths().tolist() else: cell = cell.tolist() tokens.append("cell={0}".format(cell) + ",\n") if self._calc is not None: tokens.append("calculator={0}".format(self._calc.__class__.__name__)) txt = "{0}(\n{1}{2})".format( self.__class__.__name__, insep, insep.join(tokens) + "..." ) return txt def __add__(self, other): qbits = self.copy() qbits += other return qbits
[docs] def extend(self, other): """Extend qbits object by appending qbits from *other*.""" if isinstance(other, Qbit): other = self.from_qbit_list([other]) n1 = len(self) n2 = len(other) for name, a1 in self.arrays.items(): a = np.zeros((n1 + n2,) + a1.shape[1:], a1.dtype) a[:n1] = a1 if name == "masses": a2 = other.get_masses() else: a2 = other.arrays.get(name) if a2 is not None: a[n1:] = a2 self.arrays[name] = a for name, a2 in other.arrays.items(): if name in self.arrays: continue a = np.empty((n1 + n2,) + a2.shape[1:], a2.dtype) a[n1:] = a2 if name == "masses": a[:n1] = self.get_masses()[:n1] else: a[:n1] = 0 self.set_array(name, a)
def __iadd__(self, other): self.extend(other) return self
[docs] def append(self, qbit): """Append qbit to end.""" self.extend(self.__class__([qbit]))
def __iter__(self): for i in range(len(self)): yield self[i] def __getitem__(self, indices): """ Return a subset of the qbits. Parameters ---------- indices : int | list | slice The indices to be returned. Returns ------- Qbit | Qbits. If indices is a scalar a Qbit object is returned. If indices is a list or a slice, a Qbits object with the same cell, pbc, and other associated info as the original Qbits object is returned. """ if isinstance(indices, numbers.Integral): nqbits = len(self) if indices < -nqbits or indices >= nqbits: raise IndexError("Index out of range.") return Qbit(qbits=self, index=indices) if not isinstance(indices, slice): indices = np.array(indices) # if indices is a mask. if indices.dtype == bool: if len(indices) != len(self): raise IndexError( f"Length of mask {len(indices)} must equal " f"number of qbits {len(self)}" ) indices = np.arange(len(self))[indices] qbits = self.__class__( cell=self.cell, pbc=self.pbc, info=self.info, celldisp=self._celldisp, ) qbits.arrays = {} for name, a in self.arrays.items(): qbits.arrays[name] = a[indices].copy() return qbits def __delitem__(self, indices): """ Delete a subset of the qbits. Parameters ---------- indices : int | list The indices to be deleted. """ if isinstance(indices, list) and len(indices) > 0: # Make sure a list of booleans will work correctly and not be # interpreted at 0 and 1 indices. indices = np.array(indices) mask = np.ones(len(self), bool) mask[indices] = False for name, a in self.arrays.items(): self.arrays[name] = a[mask]
[docs] def pop(self, i=-1): """Remove and return qbit at index *i* (default last).""" qbit = self[i] qbit.cut_reference_to_qbits() del self[i] return qbit
def __imul__(self, m): """In-place repeat of qbits.""" if isinstance(m, int): m = (m, m, m) for x, vec in zip(m, self.cell): if x != 1 and not vec.any(): raise ValueError("Cannot repeat along undefined lattice " "vector") M = np.prod(m) n = len(self) for name, a in self.arrays.items(): self.arrays[name] = np.tile(a, (M,) + (1,) * (len(a.shape) - 1)) positions = self.arrays["positions"] i0 = 0 for m0 in range(m[0]): for m1 in range(m[1]): for m2 in range(m[2]): i1 = i0 + n positions[i0:i1] += np.dot((m0, m1, m2), self.cell) i0 = i1 if self.constraints is not None: self.constraints = [c.repeat(m, n) for c in self.constraints] self.cell = np.array([m[c] * self.cell[c] for c in range(3)]) new_shape = tuple(self.shape * np.array(m)) self.shape = new_shape return self
[docs] def draw(self, radius=None, show_labels=False, colouring=None, units=None): """ Visualize the positions of a set of qubits. Parameters ---------- radius: float | str A cutoff radius for visualizing bonds. Pass 'nearest' to set the radius to the smallest distance between the passed qubits. If no value is passed the bonds will not be visualized. show_labels: bool Whether to show the labels of the qubits. Defaults to False. colouring: str | list A set of integers used to assign different colors to each Qubit. This can be used to view different magnetic orderings. Must have the same length as the number of Qubits. units : str, optional The units of distance. See Also -------- qse.draw """ _draw( self, radius=radius, show_labels=show_labels, colouring=colouring, units=units, )
[docs] def repeat(self, rep): """Create new repeated qbits object. The *rep* argument should be a sequence of three positive integers like *(2,3,1)* or a single integer (*r*) equivalent to *(r,r,r)*.""" qbits = self.copy() qbits *= rep return qbits
def __mul__(self, rep): return self.repeat(rep)
[docs] def translate(self, displacement): """ Translate qbit positions. Parameters ---------- displacement : float | np.ndarray The displacement argument can be a float an xyz vector or an nx3 array (where n is the number of qbits). """ self.positions += np.array(displacement)
[docs] def center_in_unit_cell(self, vacuum=None, axis=(0, 1, 2), about=None): """ Center qbits in unit cell. Centers the qbits in the unit cell, so there is the same amount of vacuum on all sides. vacuum: float (default: None) If specified adjust the amount of vacuum when centering. If vacuum=10.0 there will thus be 10 Angstrom of vacuum on each side. axis: int or sequence of ints Axis or axes to act on. Default: Act on all axes. about: float or array (default: None) If specified, center the qbits about <about>. I.e., about=(0., 0., 0.) (or just "about=0.", interpreted identically), to center about the origin. """ # Find the orientations of the faces of the unit cell cell = self.cell.complete() dirs = np.zeros_like(cell) lengths = cell.lengths() for i in range(3): dirs[i] = np.cross(cell[i - 1], cell[i - 2]) dirs[i] /= np.linalg.norm(dirs[i]) if dirs[i] @ cell[i] < 0.0: dirs[i] *= -1 if isinstance(axis, int): axes = (axis,) else: axes = axis # Now, decide how much each basis vector should be made longer pos = self.positions longer = np.zeros(3) shift = np.zeros(3) for i in axes: if len(pos): scalarprod = pos @ dirs[i] p0 = scalarprod.min() p1 = scalarprod.max() else: p0 = 0 p1 = 0 height = cell[i] @ dirs[i] if vacuum is not None: lng = (p1 - p0 + 2 * vacuum) - height else: lng = 0.0 # Do not change unit cell size! top = lng + height - p1 shf = 0.5 * (top - p0) cosphi = cell[i] @ dirs[i] / lengths[i] longer[i] = lng / cosphi shift[i] = shf / cosphi # Now, do it! translation = np.zeros(3) for i in axes: nowlen = lengths[i] if vacuum is not None: self.cell[i] = cell[i] * (1 + longer[i] / nowlen) translation += shift[i] * cell[i] / nowlen # We calculated translations using the completed cell, # so directions without cell vectors will have been centered # along a "fake" vector of length 1. # Therefore, we adjust by -0.5: if not any(self.cell[i]): translation[i] -= 0.5 # Optionally, translate to center about a point in space. if about is not None: for vector in self.cell: translation -= vector / 2.0 translation += about self.positions += translation
[docs] def get_centroid(self): r""" Get the centroid of the positions. Returns ------- np.ndarray The centroid of the positions. Notes ----- For a set of :math:`k` positions :math:`\textbf{x}_1, \textbf{x}_2, ..., \textbf{x}_k` the centroid is given by .. math:: \frac{\textbf{x}_1 + \textbf{x}_2 + ... + \textbf{x}_k}{k}. """ return self.positions.mean(0)
[docs] def set_centroid(self, centroid): r""" Set the centroid of the positions. Parameters ---------- centroid : float | np.ndarray The new centroid. Can be a float or a xyz vector Notes ----- For a set of :math:`k` positions :math:`\textbf{x}_1, \textbf{x}_2, ..., \textbf{x}_k` the centroid is given by .. math:: \frac{\textbf{x}_1 + \textbf{x}_2 + ... + \textbf{x}_k}{k}. """ self.positions += centroid - self.get_centroid()
[docs] def rotate(self, a, v="z", center=(0, 0, 0), rotate_cell=False): r""" Rotate qbits based on a vector and an angle, or two vectors. Parameters ---------- a : Angle that the qbits is rotated (anticlockwise) around the vector 'v'. 'a' can also be a vector and then 'a' is rotated into 'v'. If 'a' is an angle it must be in degrees. v : Vector to rotate the qbits around. Vectors can be given as strings: 'x', '-x', 'y', ... . Defaults to 'z'. center : The center is kept fixed under the rotation. Use 'COP' to fix the center of positions or 'COU' to fix the center of cell. Defaults to = (0, 0, 0). rotate_cell = False: If true the cell is also rotated. Examples -------- The following all rotate 90 degrees anticlockwise around the z-axis, so that the x-axis is rotated into the y-axis: >>> qbits.rotate(90) >>> qbits.rotate(90, 'z') >>> qbits.rotate(90, (0, 0, 1)) >>> qbits.rotate(-90, '-z') >>> qbits.rotate('x', 'y') >>> qbits.rotate((1, 0, 0), (0, 1, 0)) Notes ----- If 'a' is an angle, :math:`\theta`, and if :math:`\textbf{v}` is the vector then we define .. math:: R = \cos(\theta)I + \sin(\theta)[\textbf{v}]_\times + (1-\cos(\theta))\textbf{v}\textbf{v}^T where :math:`[\textbf{v}]_\times \textbf{x} = \textbf{v} \times \textbf{x}`. If :math:`\textbf{r}` is a coordinate vector and :math:`\textbf{c}` is the center, this transforms the coordinate vector to .. math:: \textbf{r} \rightarrow R(\textbf{r}-\textbf{c}) + \textbf{c}. """ if not isinstance(a, numbers.Real): a, v = v, a v = _norm_vector(_string2vector(v)) if isinstance(a, numbers.Real): a = _to_rads(a) c = cos(a) s = sin(a) else: v2 = _norm_vector(_string2vector(a)) c = np.dot(v, v2) v = np.cross(v, v2) s = np.linalg.norm(v) # In case *v* and *a* are parallel, np.cross(v, v2) vanish # and can't be used as a rotation axis. However, in this # case any rotation axis perpendicular to v2 will do. eps = 1e-7 if s < eps: v = np.cross((0, 0, 1), v2) if np.linalg.norm(v) < eps: v = np.cross((1, 0, 0), v2) assert np.linalg.norm(v) >= eps elif s > 0: v /= s center = self._centering_as_array(center) p = self.arrays["positions"] - center self.arrays["positions"][:] = ( c * p - np.cross(p, s * v) + np.outer(np.dot(p, v), (1.0 - c) * v) + center ) if rotate_cell: rotcell = self.get_cell() rotcell[:] = ( c * rotcell - np.cross(rotcell, s * v) + np.outer(np.dot(rotcell, v), (1.0 - c) * v) ) self.set_cell(rotcell)
def _centering_as_array(self, center): if isinstance(center, str): if center.lower() == "cop": center = self.get_centroid() elif center.lower() == "cou": center = self.get_cell().sum(axis=0) / 2 else: raise ValueError("Cannot interpret center") else: center = np.array(center, float) return center
[docs] def euler_rotate(self, phi=0.0, theta=0.0, psi=0.0, center=(0, 0, 0)): r""" Rotate qbits via Euler angles (in degrees). Parameters ---------- phi : float The 1st rotation angle around the z axis. theta : float Rotation around the x axis. psi : float 2nd rotation around the z axis. center : The point to rotate about. A sequence of length 3 with the coordinates, or 'COM' to select the center of mass, 'COP' to select center of positions or 'COU' to select center of cell. Notes ----- Let .. math:: R = \begin{pmatrix} \cos(\psi ) & \sin(\psi ) & 0 \\ -\sin(\psi ) & \cos(\psi ) & 0\\ 0 & 0 & 1\\ \end{pmatrix} \begin{pmatrix} 1 & 0 & 0\\ 0 & \cos(\theta ) & \sin(\theta ) \\ 0 & -\sin(\theta ) & \cos(\theta ) \\ \end{pmatrix} \begin{pmatrix} \cos(\phi ) & \sin(\phi ) & 0 \\ -\sin(\phi ) & \cos(\phi ) & 0\\ 0 & 0 & 1\\ \end{pmatrix} then if :math:`\textbf{r}` is a coordinate vector and :math:`\textbf{c}` is the center, this transforms the coordinate vector to .. math:: \textbf{r} \rightarrow R(\textbf{r}-\textbf{c}) + \textbf{c}. """ def rotation_mat(angle): return np.array( [ [np.cos(angle), np.sin(angle)], [-np.sin(angle), np.cos(angle)], ] ) # First Euler rotation about z in matrix form D = np.eye(3) D[:-1, :-1] = rotation_mat(_to_rads(phi)) # Second Euler rotation about x: C = np.eye(3) C[1:, 1:] = rotation_mat(_to_rads(theta)) # Third Euler rotation, 2nd rotation about z: B = np.eye(3) B[:-1, :-1] = rotation_mat(_to_rads(psi)) # Total Euler rotation A = np.dot(B, np.dot(C, D)) # Move the molecule to the origin. rcoords = self.positions - self._centering_as_array(center) # Do the rotation rcoords = np.dot(A, np.transpose(rcoords)) # Move back to the rotation point self.positions = np.transpose(rcoords) + center
[docs] def get_dihedral(self, a0, a1, a2, a3, mic=False): """Calculate dihedral angle. Calculate dihedral angle (in degrees) between the vectors a0->a1 and a2->a3. Use mic=True to use the Minimum Image Convention and calculate the angle across periodic boundaries. """ return self.get_dihedrals([[a0, a1, a2, a3]], mic=mic)[0]
[docs] def get_dihedrals(self, indices, mic=False): """Calculate dihedral angles. Calculate dihedral angles (in degrees) between the list of vectors a0->a1 and a2->a3, where a0, a1, a2 and a3 are in each row of indices. Use mic=True to use the Minimum Image Convention and calculate the angles across periodic boundaries. """ indices = np.array(indices) assert indices.shape[1] == 4 a0s = self.positions[indices[:, 0]] a1s = self.positions[indices[:, 1]] a2s = self.positions[indices[:, 2]] a3s = self.positions[indices[:, 3]] # vectors 0->1, 1->2, 2->3 v0 = a1s - a0s v1 = a2s - a1s v2 = a3s - a2s cell = None pbc = None if mic: cell = self.cell pbc = self.pbc return get_dihedrals(v0, v1, v2, cell=cell, pbc=pbc)
def _masked_rotate(self, center, axis, diff, mask): # do rotation of subgroup by copying it to temporary qbits object # and then rotating that # # recursive object definition might not be the most elegant thing, # more generally useful might be a rotation function with a mask? group = self.__class__() for i in range(len(self)): if mask[i]: group += self[i] group.translate(-center) group.rotate(diff * 180 / np.pi, axis) group.translate(center) # set positions in original qbits object j = 0 for i in range(len(self)): if mask[i]: self.positions[i] = group[j].position j += 1
[docs] def set_dihedral(self, a1, a2, a3, a4, angle, mask=None, indices=None): """Set the dihedral angle (degrees) between vectors a1->a2 and a3->a4 by changing the qbit indexed by a4. If mask is not None, all the qbits described in mask (read: the entire subgroup) are moved. Alternatively to the mask, the indices of the qbits to be rotated can be supplied. If both *mask* and *indices* are given, *indices* overwrites *mask*. **Important**: If *mask* or *indices* is given and does not contain *a4*, *a4* will NOT be moved. In most cases you therefore want to include *a4* in *mask*/*indices*. Example: the following defines a very crude ethane-like molecule and twists one half of it by 30 degrees. >>> qbits = Qbits('HHCCHH', [[-1, 1, 0], [-1, -1, 0], [0, 0, 0], ... [1, 0, 0], [2, 1, 0], [2, -1, 0]]) >>> qbits.set_dihedral(1, 2, 3, 4, 210, mask=[0, 0, 0, 1, 1, 1]) """ angle = _to_rads(angle) # if not provided, set mask to the last qbit in the # dihedral description if mask is None and indices is None: mask = np.zeros(len(self)) mask[a4] = 1 elif indices is not None: mask = [index in indices for index in range(len(self))] # compute necessary in dihedral change, from current value current = _to_rads(self.get_dihedral(a1, a2, a3, a4)) diff = angle - current axis = self.positions[a3] - self.positions[a2] center = self.positions[a3] self._masked_rotate(center, axis, diff, mask)
[docs] def rotate_dihedral(self, a1, a2, a3, a4, angle=None, mask=None, indices=None): """Rotate dihedral angle. Same usage as in :meth:`ase.Qbits.set_dihedral`: Rotate a group by a predefined dihedral angle, starting from its current configuration. """ start = self.get_dihedral(a1, a2, a3, a4) self.set_dihedral(a1, a2, a3, a4, angle + start, mask, indices)
[docs] def get_angle(self, i: int, j: int, k: int): """ Get the angle in degress formed by three qubits. Parameters ---------- i : int The index of the first qubit. j : int The index of the second qubit. k : int The index of the third qubit. Returns ------- float The angle between the qubits. Notes ----- Let x1, x2, x3 be the vectors describing the positions of the three qubits. Then we calcule the angle between x1-x2 and x3-x2. """ v1 = _norm_vector(self.positions[i] - self.positions[j]) v2 = _norm_vector(self.positions[k] - self.positions[j]) dot_prod = np.dot(v1, v2) # The if-statements are in case of floating point errors. if dot_prod >= 1.0: return 0.0 if dot_prod <= -1.0: return 180.0 return _to_degrees(np.arccos(dot_prod))
[docs] def get_angles(self, indices): """ Get the angle in degress formed by three qubits for multiple groupings. Parameters ---------- indices : list | np.ndarray The indices of the groupings of qubits. Must be of shape (n, 3), where n is the number of groupings. Returns ------- np.ndarray The angles between the qubits. Notes ----- Let x1, x2, x3 be the vectors describing the positions of the three qubits. Then we calcule the angle between x1-x2 and x3-x2 for all the different groupings. """ indices = np.array(indices) if indices.shape[1] != 3: raise Exception("The indicies must be of shape (-1, 3).") return np.array([self.get_angle(i, j, k) for i, j, k in indices])
[docs] def set_angle( self, a1, a2=None, a3=None, angle=None, mask=None, indices=None, add=False ): """ Set angle (in degrees) formed by three qbits. Sets the angle between vectors *a2*->*a1* and *a2*->*a3*. If *add* is `True`, the angle will be changed by the value given. Same usage as in :meth:`ase.Qbits.set_dihedral`. If *mask* and *indices* are given, *indices* overwrites *mask*. If *mask* and *indices* are not set, only *a3* is moved. """ if any(a is None for a in [a2, a3, angle]): raise ValueError("a2, a3, and angle must not be None") # If not provided, set mask to the last qbit in the angle description if mask is None and indices is None: mask = np.zeros(len(self)) mask[a3] = 1 elif indices is not None: mask = [index in indices for index in range(len(self))] if add: diff = angle else: # Compute necessary in angle change, from current value diff = angle - self.get_angle(a1, a2, a3) diff = _to_rads(diff) # Do rotation of subgroup by copying it to temporary qbits object and # then rotating that v10 = self.positions[a1] - self.positions[a2] v12 = self.positions[a3] - self.positions[a2] v10 /= np.linalg.norm(v10) v12 /= np.linalg.norm(v12) axis = np.cross(v10, v12) center = self.positions[a2] self._masked_rotate(center, axis, diff, mask)
[docs] def rattle(self, stdev=0.001, seed=None, rng=None): """Randomly displace qbits. This method adds random displacements to the qbit positions, taking a possible constraint into account. The random numbers are drawn from a normal distribution of standard deviation stdev. For a parallel calculation, it is important to use the same seed on all processors!""" if seed is not None and rng is not None: raise ValueError("Please do not provide both seed and rng.") if rng is None: if seed is None: seed = 42 rng = np.random.RandomState(seed) self.positions += rng.normal(scale=stdev, size=self.positions.shape)
[docs] def get_distance(self, i, j): """ Return the distance between two qbits. Parameters ---------- i : int The index of the first qubit. j : int The index of the second qubit. Returns ------- float The distance between the qubits. """ return np.linalg.norm(self.positions[i] - self.positions[j])
[docs] def get_distances(self, i, indices): """ Return distances of the ith qubit with a list of qubits. Parameters ---------- i : int The index of the ith qubit. indices : list[int] The indices of other qubits. Returns ------- np.ndarray An array containing the distances. """ return np.array([self.get_distance(i, j) for j in indices])
[docs] def get_all_distances(self): """ Return the distances of all of the qubits with all of the other qubits. Returns ------- np.ndarray An array of shape (nqbits, nqbits) containing the distances. """ distances = np.zeros((self.nqbits, self.nqbits)) for i in range(self.nqbits - 1): for j in range(i + 1, self.nqbits): distances[i, j] = distances[j, i] = self.get_distance(i, j) return distances
[docs] def set_distance( self, a0, a1, distance, fix=0.5, mic=False, mask=None, indices=None, add=False, factor=False, ): """Set the distance between two qbits. Set the distance between qbits *a0* and *a1* to *distance*. By default, the center of the two qbits will be fixed. Use *fix=0* to fix the first qbit, *fix=1* to fix the second qbit and *fix=0.5* (default) to fix the center of the bond. If *mask* or *indices* are set (*mask* overwrites *indices*), only the qbits defined there are moved (see :meth:`ase.Qbits.set_dihedral`). When *add* is true, the distance is changed by the value given. In combination with *factor* True, the value given is a factor scaling the distance. It is assumed that the qbits in *mask*/*indices* move together with *a1*. If *fix=1*, only *a0* will therefore be moved.""" if a0 % len(self) == a1 % len(self): raise ValueError("a0 and a1 must not be the same") if add: oldDist = self.get_distance(a0, a1, mic=mic) if factor: newDist = oldDist * distance else: newDist = oldDist + distance self.set_distance( a0, a1, newDist, fix=fix, mic=mic, mask=mask, indices=indices, add=False, factor=False, ) return R = self.arrays["positions"] D = np.array([R[a1] - R[a0]]) if mic: D, D_len = find_mic(D, self.cell, self.pbc) else: D_len = np.array([np.sqrt((D**2).sum())]) x = 1.0 - distance / D_len[0] if mask is None and indices is None: indices = [a0, a1] elif mask: indices = [i for i in range(len(self)) if mask[i]] for i in indices: if i == a0: R[a0] += (x * fix) * D[0] else: R[i] -= (x * (1.0 - fix)) * D[0]
[docs] def get_scaled_positions(self, wrap=True): """Get positions relative to unit cell. If wrap is True, qbits outside the unit cell will be wrapped into the cell in those directions with periodic boundary conditions so that the scaled coordinates are between zero and one. If any cell vectors are zero, the corresponding coordinates are evaluated as if the cell were completed using ``cell.complete()``. This means coordinates will be Cartesian as long as the non-zero cell vectors span a Cartesian axis or plane.""" fractional = self.cell.scaled_positions(self.positions) if wrap: for i, periodic in enumerate(self.pbc): if periodic: # Yes, we need to do it twice. # See the scaled_positions.py test. fractional[:, i] %= 1.0 fractional[:, i] %= 1.0 return fractional
[docs] def set_scaled_positions(self, scaled): """Set positions relative to unit cell.""" self.positions[:] = self.cell.cartesian_positions(scaled)
[docs] def wrap(self, **wrap_kw): """Wrap positions to unit cell. Parameters: wrap_kw: (keyword=value) pairs optional keywords `pbc`, `center`, `pretty_translation`, `eps`, see :func:`ase.geometry.wrap_positions` """ if "pbc" not in wrap_kw: wrap_kw["pbc"] = self.pbc self.positions[:] = self.get_positions(wrap=True, **wrap_kw)
def __eq__(self, other): """Check for identity of two qbits objects. Identity means: same positions, states, unit cell and periodic boundary conditions.""" if not isinstance(other, Qbits): return False a = self.arrays b = other.arrays return ( len(self) == len(other) and (a["positions"] == b["positions"]).all() and (a["states"] == b["states"]).all() and (self.cell == other.cell).all() and (self.pbc == other.pbc).all() ) def __ne__(self, other): """Check if two qbits objects are not equal. Any differences in positions, states, unit cell or periodic boundary condtions make qbits objects not equal. """ eq = self.__eq__(other) if eq is NotImplemented: return eq else: return not eq
[docs] def get_volume(self): """Get volume of unit cell.""" if self.cell.rank != 3: raise ValueError( "You have {0} lattice vectors: volume not defined".format( self.cell.rank ) ) return self.cell.volume
def _get_positions(self): """Return reference to positions-array for in-place manipulations.""" return self.arrays["positions"] def _set_positions(self, pos): """Set positions directly, bypassing constraints.""" self.arrays["positions"][:] = pos positions = property( _get_positions, _set_positions, doc="Attribute for direct " + "manipulation of the positions.", ) # Rajarshi: Below these three written to add attribute of states def _get_states(self): """Return reference to states-array for in-place manipulations.""" return self.arrays["states"] def _set_states(self, sts): """Set states directly, bypassing constraints.""" self.arrays["states"][ : ] = sts # (sts.T / np.linalg.norm(sts, axis=1)).T # need to be normalized # below is equivalent to defining @property states states = property( _get_states, _set_states, doc="Attribute for direct " + "manipulation of the states.", ) # Rajarshi: Write method to get labels def _get_labels(self): """Return array of labels""" return self.arrays["labels"] def _set_labels(self, lbs): """Set the labels directly.""" self.arrays["labels"][:] = lbs labels = property( _get_labels, _set_labels, doc="Attribute for direct manipulation of labels" ) @property def cell(self): """The :class:`ase.cell.Cell` for direct manipulation.""" return self._cellobj @cell.setter def cell(self, cell): cell = Cell.ascell(cell) self._cellobj[:] = cell
[docs] def write(self, filename, format=None, **kwargs): """Write qbits object to a file. see ase.io.write for formats. kwargs are passed to ase.io.write. """ from pickle import dump dump(obj=self.todict(), file=open(filename, "wb"), **kwargs)
def iterimages(self): yield self def to_pulser(self): from pulser import Register return Register.from_coordinates(self.positions[:, :2], prefix="q")
# # Rajarshi: Deleted the edit method, which in original # ASE approach lets users manipulate Atoms object. At # some stage we may adopt similar approach depending on # the usage/usecase. # def edit(self): Modify qbits interactively through ASE's GUI viewer. def _norm_vector(v): normv = np.linalg.norm(v) if normv == 0.0: raise ZeroDivisionError("Vector has 0 norm.", v) return v / normv def _to_rads(a): return a * np.pi / 180 def _to_degrees(a): return 180 * a / np.pi def _string2vector(v): """Used in rotate method to rotate qbit location""" if isinstance(v, str): if v[0] == "-": return -_string2vector(v[1:]) w = np.zeros(3) w["xyz".index(v)] = 1.0 return w return np.array(v, float) def default(data, dflt): """Helper function for setting default values.""" if data is None: return None elif isinstance(data, (list, tuple)): newdata = [] allnone = True for x in data: if x is None: newdata.append(dflt) else: newdata.append(x) allnone = False if allnone: return None return newdata else: return data